W i l l k o m m e n   b e i   [ www.mauspfeil.com ]
 
 



 

Wörterbuch der Bedeutung
<<Zurück
Bitte wählen Sie einen Buchstaben:
A, Ä | B | C | D | E | F | G | H | I | J | K | L | M | N | O, Ö | P | Q | R | S | T | U, Ü | V | W | X | Y | Z | 0-9

Suchen:

(Groß-/Kleinschreibung wird nicht unterschieden)

Google


QDX

*** Shopping-Tipp: QDX

{{Infobox Chemikalie | Strukturformel = Bild:1-(3,5,7-trinitro-1,3,5,7-tetrazocan-1-yl)ethanone.svg | Andere Namen = * 1-(3,5,7-Trinitro-1,3,5,7-tetrazocan-1-yl)ethanon * 1-Acetyl-3,5,7-trinitro-1,3,5,7-octahydrotetrazocine * SEX * Solex | Summenformel = {{Chemieformel|C|6|H|11|O|7|N|7}} | CAS = 13980-00-2 | SMILES = CC(=O)N1CN(CN(CN(C1)[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] | Beschreibung = Sprengstoff | Molmasse = 293,2 g·mol-1 | Aggregat = fest | Dichte = | Schmelzpunkt = | Siedepunkt = | Dampfdruck = | Dampfdrucktemp = | Löslichkeit = | Gefahrensymbole = {{Gefahrensymbole|E}} | RL 67/548/EWG = Nein | R = {{R-Sätze|?}} | S = {{S-Sätze|?}} | MAK = }} '''QDX''' ist ein Sprengstoff, der von der chemischen Struktur mit Oktogen verwandt ist.[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=26367 Eintrag bei PubChem] Bei der Herstellung von Oktogen fällt QDX als Nebenprodukt an.Elizabeth P. Burrows, Ernst E. Brueggemann: ''[http://dx.doi.org/10.1016/S0021-9673(01)81932-4 Reversed-phase gradient high-performance liquid chromatography of nitramine munitions and characterization of munitions process samples by gas chromatography-mass spectrometry]''. Journal of Chromatography A Volume 329, 1985, Pages 285–289

Toxikologie
Der Stoff kann sowohl oral, als auch über die Haut aufgenommen werden. Im Tierversuch erzeugte QDX bei Kaninchen und Ratten Schädigungen der Leber, Hypermotilität des Magen-Darm-Trakt Gastrointestinaltrakts und Durchfall.[http://chem.sis.nlm.nih.gov/chemidplus/jsp/common/ChemFull.jsp?MW=293.1949 U.S. National Library of Medicine]

Quellen
Kategorie:Chemische Verbindung Kategorie:Sprengstoff




[Der Artikel zu QDX stammt aus dem Nachschlagewerk Wikipedia, der freien Enzyklopädie. Dort findet sich neben einer Übersicht der Autoren die Möglichkeit, den Original-Text des Artikels QDX zu editieren.
Die Texte von Wikipedia und dieser Seite stehen unter der GNU Free Documentation License.]

<<Zurück | Zur Startseite | Impressum | Zum Beginn dieser Seite